CymitQuimica logo

CAS 288144-42-3

:

N-[2-[[(2R)-2-amino-3-sulfanyl-propanoyl]amino]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide; 2,2,2-trifluoroacetic acid

Description:
The chemical substance N-[2-[[(2R)-2-amino-3-sulfanyl-propanoyl]amino]ethyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanamide; 2,2,2-trifluoroacetic acid, with CAS number 288144-42-3, is a complex organic compound characterized by its multi-functional structure, which includes amino acids and thienoimidazole moieties. This compound features a thieno[3,4-d]imidazole ring, which contributes to its potential biological activity, possibly as a pharmaceutical agent. The presence of a sulfanyl group indicates potential reactivity and interactions with biological systems, while the trifluoroacetic acid component suggests that it may be used in various chemical reactions or as a solvent. The compound's structure implies it may exhibit properties such as solubility in polar solvents, potential for hydrogen bonding due to the presence of amino and carboxylic functional groups, and possible interactions with biological targets, making it of interest in medicinal chemistry. Overall, its unique structural features may confer specific pharmacological properties, warranting further investigation.
Formula:C15H27N5O3S2
InChI:InChI=1/C15H27N5O3S2.C2HF3O2/c16-9(7-24)14(22)18-6-5-17-12(21)4-2-1-3-11-13-10(8-25-11)19-15(23)20-13;3-2(4,5)1(6)7/h9-11,13,24H,1-8,16H2,(H,17,21)(H,18,22)(H2,19,20,23);(H,6,7)/t9-,10?,11-,13?;/m0./s1
SMILES:C(CCC(=NCCN=C([C@H](CS)N)O)O)C[C@H]1C2C(CS1)N=C(N2)O.C(=O)(C(F)(F)F)O
Synonyms:
  • N-Biotinyl-N’-cysteinyl EthylenediamineDiscontinued See: B395826
  • (3aS,4S,6aR)-N-[2-[[(2R)-2-Amino-3-mercapto-1-oxopropyl]amino]ethyl]hexahydro-2-oxo-1H-thieno[3,4-d]imidazole-4-pentanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.