CAS 2882-18-0
:3-phenylpyrazin-2(1H)-one
Description:
3-Phenylpyrazin-2(1H)-one, with the CAS number 2882-18-0, is an organic compound characterized by its pyrazinone structure, which features a pyrazine ring fused with a carbonyl group and a phenyl substituent. This compound typically exhibits a white to light yellow crystalline appearance and is soluble in organic solvents. Its molecular structure includes a five-membered heterocyclic ring containing two nitrogen atoms, contributing to its unique chemical properties. 3-Phenylpyrazin-2(1H)-one is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The compound's reactivity can be influenced by the presence of the phenyl group, which can participate in various chemical reactions, including electrophilic substitutions. Additionally, its stability and behavior in different environments can be affected by factors such as pH and temperature. Overall, 3-phenylpyrazin-2(1H)-one serves as a valuable compound in both synthetic chemistry and medicinal applications.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-10-9(11-6-7-12-10)8-4-2-1-3-5-8/h1-7H,(H,12,13)
SMILES:c1ccc(cc1)c1c(=O)[nH]ccn1
Synonyms:- 2(1H)-Pyrazinone, 3-phenyl-
- 2-Pyrazinol, 3-Phenyl-
- 3-Phenylpyrazin-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2(1H)-Pyrazinone, 3-phenyl-
CAS:Formula:C10H8N2OPurity:97%Color and Shape:SolidMolecular weight:172.18332-Hydroxy-3-phenylpyrazine
CAS:Controlled ProductImpurity Cefaclor EP Impurity F/ Ampicillin EP Impurity H
Applications 2-Hydroxy-3-phenylpyrazine (Cefaclor EP Impurity F) is a degradation product of Cefaclor (C235250), a second-generation cephalosporin antibiotic.
References Baertschi, S.W., et al.: J. Pharma. Sci., 82, 622 (1993); Gray, B.M., et al.: Antimicrob. Agents Chemother., 13, 988 (1978), Lorenz, L.J., et al.: Anal. Profiles Drug Subs., 9, 107 (1980), Hori, R., et al.: J. Pharm. Pharmacol., 40, 646 (1988),Formula:C10H8N2OColor and Shape:NeatMolecular weight:172.18



