CAS 28821-35-4
:3,6,9,12,15,18,21,24,27,30,33,36,39,42-Tetradecaoxatetratetracontane-1,44-diol
Description:
3,6,9,12,15,18,21,24,27,30,33,36,39,42-Tetradecaoxatetratetracontane-1,44-diol, with CAS number 28821-35-4, is a synthetic polyether compound characterized by a long carbon chain with multiple ether linkages and hydroxyl groups. This structure imparts unique properties, such as increased solubility in polar solvents and potential applications in surfactants or emulsifiers. The presence of multiple ether groups enhances its flexibility and lowers its melting point compared to similar hydrocarbons. The diol functionality suggests it can participate in hydrogen bonding, which may influence its physical properties, such as viscosity and surface tension. Additionally, the compound's long carbon chain may contribute to its hydrophobic characteristics, making it suitable for various industrial applications, including lubricants and coatings. Its complex structure also indicates potential for use in specialized chemical synthesis or as a building block in polymer chemistry. However, specific applications and behaviors would depend on further empirical studies and characterization.
Formula:C30H62O16
InChI:InChI=1S/C30H62O16/c31-1-3-33-5-7-35-9-11-37-13-15-39-17-19-41-21-23-43-25-27-45-29-30-46-28-26-44-24-22-42-20-18-40-16-14-38-12-10-36-8-6-34-4-2-32/h31-32H,1-30H2
InChI key:InChIKey=OWTQQPNDSWCHOV-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCOCCOCCO)OCCOCCOCCOCCOCCOCCOCCO
Synonyms:- 3,6,9,12,15,18,21,24,27,30,33,36,39,42-Tetradecaoxatetratetracontane-1,44-diol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
HO-PEG15-OH
CAS:HO-PEG15-OH is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.Formula:C30H62O16Purity:98%Color and Shape:SolidMolecular weight:678.8HO-PEG15-OH
CAS:HO-PEG15-OH is a molecule in the form of a polymer that has been synthesized by the reaction of HO-PEG with an OH group. The sequence of HO-PEG15-OH contains three disulfide bonds, which provide stability to the molecule. This product has shown to be biocompatible and can be used as a drug delivery system for various pharmaceutical products. For example, it can be used to deliver silver ions to kill bacteria or hydroxy groups to treat cancer cells. HO-PEG15-OH is also useful for increasing plasma concentrations of drugs such as chemotherapeutic agents and immunosuppressants. It is capable of binding to hydroxyl groups on the surface of human ovarian carcinoma cells and carcinoma cell lines, which may lead to increased cytotoxicity.Formula:C30H62O16Purity:Min. 95%Molecular weight:678.81 g/mol




