CAS 28824-91-1

1-(5-methyl-2-phenyl-1H-imidazol-4-yl)ethanone

Description:

1-(5-methyl-2-phenyl-1H-imidazol-4-yl)ethanone, with the CAS number 28824-91-1, is an organic compound characterized by its imidazole ring structure, which contributes to its potential biological activity. This compound features a ketone functional group, specifically an ethanone moiety, which is linked to a substituted imidazole. The presence of the methyl and phenyl groups enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential antimicrobial or antifungal activities. The imidazole ring is known for its role in various biochemical processes, making such derivatives of interest in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can vary based on the substituents and the overall molecular structure, which are crucial for its application in drug development or as a chemical probe in research. Safety and handling considerations should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₁₂N₂O

InChI: InChI=1/C12H12N2O/c1-8-11(9(2)15)14-12(13-8)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,13,14)

SMILES: Cc1c(C(=O)C)[nH]c(c2ccccc2)n1

1-(5-methyl-2-phenyl-1H-imidazol-4-yl)ethan-1-one

CAS: 28824-91-1

Formula: C₁₂H₁₂N₂O

Purity: 98%

Molecular weight: 200.2365

Ref: IN-DA019N0P

1-(4-Methyl-2-phenyl-1H-imidazol-5-yl)ethanone

CAS: 28824-91-1

1-(4-Methyl-2-phenyl-1H-imidazol-5-yl)ethanone

Purity: 98%

Molecular weight: 200.24g/mol

Ref: 54-OR78137

1-(4-Methyl-2-phenyl-1H-imidazol-5-yl)ethanone

CAS: 28824-91-1

Purity: 98%

Molecular weight: 200.2409973

Ref: 10-F779467