CAS 28824-94-4
:4-Methyl-2-phenyl-1H-imidazole-5-carboxylic acid
Description:
4-Methyl-2-phenyl-1H-imidazole-5-carboxylic acid, with the CAS number 28824-94-4, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methyl group and a phenyl group on the imidazole ring enhances its chemical reactivity and solubility in various solvents. It is typically a crystalline solid at room temperature and may exhibit moderate stability under standard conditions. The compound is of interest in medicinal chemistry and may have applications in pharmaceuticals due to its potential biological activity. Its synthesis often involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-7-9(11(14)15)13-10(12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,12,13)(H,14,15)
InChI key:InChIKey=NEDPOZZCAYIDNP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1NC(=NC1C)C2=CC=CC=C2
Synonyms:- 5-Methyl-2-phenyl-1H-imidazole-4-carboxylic acid
- Imidazole-4-carboxylic acid, 5-methyl-2-phenyl-
- 1H-Imidazole-5-carboxylic acid, 4-methyl-2-phenyl-
- 4-Methyl-2-phenyl-1H-imidazole-5-carboxylic acid
- 1H-Imidazole-4-carboxylic acid, 5-methyl-2-phenyl-
- 1H-Imidazole-5-carboxylicacid, 4-methyl-2-phenyl-
- 5-methyl-2-phenyl-1H-imidazole-4-carboxylic acid(SALTDATA: FREE)
- 2-Phenyl-4-methyl-1H-imidazole-5-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Imidazole-5-carboxylic acid, 4-methyl-2-phenyl-
CAS:Formula:C11H10N2O2Purity:95%Molecular weight:202.20935-Methyl-2-phenyl-1H-imidazole-4-carboxylic acid
CAS:<p>5-Methyl-2-phenyl-1H-imidazole-4-carboxylic acid (MPICA) is a potent inhibitor of xanthine oxidase. It is also an inhibitor of β-glucuronidase and enzymes that maintain the integrity of bacterial DNA. MPICA has been shown to inhibit xanthine oxidase in a dose dependent manner and can be used as a lead compound for new inhibitors of this enzyme.</p>Formula:C11H10N2O2Purity:Min. 95%Color and Shape:White PowderMolecular weight:202.21 g/mol5-methyl-2-phenyl-1H-imidazole-4-carboxylic acid
CAS:Formula:C11H10N2O2Purity:≥95%Color and Shape:SolidMolecular weight:202.213


