CAS 288246-16-2

4-bromo-1H-pyrazole-3-carbonitrile

Description:

4-Bromo-1H-pyrazole-3-carbonitrile is a heterocyclic organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a cyano group (-C≡N) at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. It is often used in medicinal chemistry and material science due to its potential biological activity and ability to act as a building block for more complex molecules. The cyano group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the bromine substituent can facilitate further functionalization, enhancing the compound's reactivity. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed in laboratory settings.

Formula: C₄H₂BrN₃

InChI: InChI=1/C4H2BrN3/c5-3-2-7-8-4(3)1-6/h2H,(H,7,8)

SMILES: C(#N)c1c(c[nH]n1)Br

Synonyms:

• 4-Bromo-3-cyano-1H-pyrazole
• 4-bromo-1H-pyrazole-5-carbonitrile
• 4-Bromo-2H-pyrazole-3-carbonitrile

4-Bromo-2H-pyrazole-3-carbonitrile

CAS: 288246-16-2

Formula: C₄H₂BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.9828

Ref: IN-DA002WO6

4-Bromo-1H-pyrazole-3-carbonitrile

CAS: 288246-16-2

4-Bromo-1H-pyrazole-3-carbonitrile

Formula: C₄H₂BrN₃

Purity: 98%

Color and Shape: Off-White Solid

Molecular weight: 171.98g/mol

Ref: 54-OR2487

4-Bromo-1H-pyrazole-5-carbonitrile

CAS: 288246-16-2

Formula: C₄H₂BrN₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.985

Ref: 10-F023610