CAS 28825-23-2
:Hexafluoroisopropyl methacrylate homopolymer
Description:
Hexafluoroisopropyl methacrylate homopolymer is a fluorinated polymer characterized by its unique chemical structure derived from the polymerization of hexafluoroisopropyl methacrylate monomers. This polymer exhibits excellent thermal stability and chemical resistance, making it suitable for applications in harsh environments. Its fluorinated nature imparts low surface energy, resulting in hydrophobic properties and enhanced resistance to solvents and chemicals. The polymer typically demonstrates good mechanical strength and flexibility, which can be advantageous in various industrial applications, including coatings, adhesives, and sealants. Additionally, the presence of fluorine atoms contributes to its low refractive index and potential use in optical applications. The homopolymer form indicates that it consists solely of hexafluoroisopropyl methacrylate units, without significant incorporation of other monomers, which can influence its physical and chemical properties. Overall, hexafluoroisopropyl methacrylate homopolymer is valued for its performance in specialized applications requiring durability and resistance to environmental factors.
Formula:(C7H6F6O2)x
InChI:InChI=1S/C7H6F6O2/c1-3(2)4(14)15-5(6(8,9)10)7(11,12)13/h5H,1H2,2H3
InChI key:InChIKey=FMQPBWHSNCRVQJ-UHFFFAOYSA-N
SMILES:C(OC(C(C)=C)=O)(C(F)(F)F)C(F)(F)F
Synonyms:- Methacrylic acid, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer
- Poly(hexafluoroisopropyl methacrylate)
- Methacrylic acid, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, polymers
- Hexafluoroisopropyl methacrylate polymer
- 2-Propenoic acid, 2-methyl-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
