CymitQuimica logo

CAS 288251-66-1

:

1-(4-fluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid

Description:
1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring at the para position, contributing to the compound's unique electronic and steric properties. The methyl group at the 5-position of the pyrazole ring adds to its hydrophobic character, while the carboxylic acid functional group at the 3-position introduces acidity and the potential for hydrogen bonding. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for various interactions, which can influence its solubility, reactivity, and overall stability. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, potentially affecting its pharmacokinetic properties. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and related fields.
Formula:C11H9FN2O2
InChI:InChI=1/C11H9FN2O2/c1-7-6-10(11(15)16)13-14(7)9-4-2-8(12)3-5-9/h2-6H,1H3,(H,15,16)
InChI key:InChIKey=VYEZQNYDNQBJNA-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)O)nn1c1ccc(cc1)F
Synonyms:
  • 1-(4-Fluorophenyl)-5-methyl-1H-pyrazole-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.