CAS 288252-18-6

1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-3-methyl-

Description:

1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-3-methyl- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 4-position of the pyrazole ring, contributing to its acidic properties. The presence of a 4-bromophenyl group at the 1-position enhances its reactivity and potential for forming various derivatives. Additionally, the methyl group at the 3-position adds to the compound's steric and electronic properties. This substance is typically used in pharmaceutical research and development due to its potential biological activity, including anti-inflammatory and analgesic effects. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in medicinal chemistry. As with many organic compounds, it is important to handle it with care, considering its chemical properties and potential hazards.

Formula: C₁₁H₉BrN₂O₂

InChI: InChI=1S/C11H9BrN2O2/c1-7-10(11(15)16)6-14(13-7)9-4-2-8(12)3-5-9/h2-6H,1H3,(H,15,16)

InChI key: InChIKey=BORCLBAFDUJOBH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN(N=C1C)C2=CC=C(Br)C=C2

Synonyms:

• 1-(4-Bromophenyl)-3-methylpyrazole-4-carboxylic acid
• 1-(4-Bromophenyl)-3-methyl-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 1-(4-bromophenyl)-3-methyl-

1-(4-Bromophenyl)-3-methyl-1H-pyrazole-4-carboxylic acid

CAS: 288252-18-6

Versatile small molecule scaffold

Formula: C₁₁H₉BrN₂O₂

Purity: Min. 95%

Molecular weight: 281.1 g/mol

Ref: 3D-NLA25218