CAS 288252-38-0

1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride

Description:

1-(4-Chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride, with the CAS number 288252-38-0, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a chlorophenyl group at the 1-position and a carbonyl chloride functional group at the 4-position of the pyrazole ring. The presence of the chlorophenyl moiety contributes to its potential reactivity and biological activity, while the carbonyl chloride group indicates that it can participate in acylation reactions. This compound is likely to be a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity profile suggests it could be used in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound due to the presence of the reactive carbonyl chloride group, which can release hydrochloric acid upon hydrolysis.

Formula: C₁₁H₈Cl₂N₂O

InChI: InChI=1/C11H8Cl2N2O/c1-7-10(11(13)16)6-14-15(7)9-4-2-8(12)3-5-9/h2-6H,1H3

SMILES: Cc1c(cnn1c1ccc(cc1)Cl)C(=O)Cl

1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride

CAS: 288252-38-0

Formula: C₁₁H₈Cl₂N₂O

Molecular weight: 255.1

Ref: IN-DA002WNS

1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride

CAS: 288252-38-0

1-(4-chlorophenyl)-5-methyl-1H-pyrazole-4-carbonyl chloride

Purity: ≥95%

Molecular weight: 255.10g/mol

Ref: 54-OR22964