CAS 288315-03-7
:3,3-Difluoroazetidine hydrochloride
Description:
3,3-Difluoroazetidine hydrochloride is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing nitrogen. The presence of two fluorine atoms at the 3-position of the azetidine ring imparts unique electronic and steric properties, potentially influencing its reactivity and interactions in various chemical environments. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its stability and solubility in polar solvents, particularly water. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential applications in the synthesis of more complex molecules, particularly in the pharmaceutical industry. Safety and handling precautions should be observed, as with any chemical substance, due to the presence of fluorine, which can be reactive. Overall, 3,3-Difluoroazetidine hydrochloride represents a valuable compound for research and development in various chemical and pharmaceutical applications.
Formula:C3H6ClF2N
InChI:InChI=1/C3H5F2N.ClH/c4-3(5)1-6-2-3;/h6H,1-2H2;1H
SMILES:C1C(CN1)(F)F.Cl
Synonyms:- 3,3-Difluorazetidinhydrochlorid(1:1)
- 3,3-Difluoroazetidine hydrochloride (1:1)
- Azetidine, 3,3-difluoro-, hydrochloride (1:1)
- 3,3-Difluoroazetidine HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,3-Difluoroazetidine hydrochloride, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C3H6ClF2NPurity:95%Color and Shape:White to cream to brown, Crystals or powder or crystalline powderMolecular weight:129.53Azetidine, 3,3-difluoro-, hydrochloride (1:1)
CAS:Formula:C3H6ClF2NPurity:97%Color and Shape:SolidMolecular weight:129.53623,3-Difluoroazetidine hydrochloride
CAS:3,3-Difluoroazetidine hydrochlorideFormula:C3H5F2N·ClHPurity:≥95%Color and Shape: white to off-white solidMolecular weight:129.54g/mol3,3-Difluoroazetidine Hydrochloride
CAS:Formula:C3H5F2N·HClPurity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:129.533,3-Difluoroazetidine hydrochloride
CAS:Formula:C3H6ClF2NPurity:98%Color and Shape:Chunks,Crystalline PowderMolecular weight:129.533,3-Difluoroazetidine Hydrochloride
CAS:Controlled ProductApplications 3,3-Difluoroazetidine Hydrochloride is used in preparation of Dihydropyrimidine compounds as antiviral agents.
References Song, H., et al.:U.S. Pat. Appl. Publ., (2020);Formula:C3H5F2N·HClColor and Shape:NeatMolecular weight:129.53





