CAS 28836-03-5
:Ammonium 8-anilinonaphthalene-1-sulfonate
Description:
Ammonium 8-anilinonaphthalene-1-sulfonate, with the CAS number 28836-03-5, is an organic compound that serves as a dye and a fluorescent probe in various chemical applications. It features a naphthalene backbone substituted with an aniline group and a sulfonate functional group, which enhances its solubility in water and makes it suitable for use in aqueous environments. This compound exhibits strong fluorescence properties, making it valuable in biochemical assays and as a tracer in analytical chemistry. Its amphiphilic nature allows it to interact with both polar and nonpolar environments, facilitating its use in surfactant applications. Additionally, the presence of the sulfonate group contributes to its ionic character, which can influence its behavior in solution, including its interaction with other ions and molecules. Overall, ammonium 8-anilinonaphthalene-1-sulfonate is characterized by its fluorescent properties, solubility, and versatility in various chemical and biological applications.
Formula:C16H13NO3S·H3N
InChI:InChI=1S/C16H13NO3S.H3N/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13;/h1-11,17H,(H,18,19,20);1H3
InChI key:InChIKey=IPBNQYLKHUNLQE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C=1C=2C(NC3=CC=CC=C3)=CC=CC2C=CC1.N
Synonyms:- 1-Anilino-8-naphthalenesulfonate ammonium salt
- Ammonium 1-anilinonaphthalene-8-sulfonate
- 1-Naphthalenesulfonic acid, 8-anilino-, monoammonium salt
- 1-Naphthalenesulfonic acid, 8-(phenylamino)-, ammonium salt (1:1)
- 1-Naphthalenesulfonic acid, 8-(phenylamino)-, monoammonium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
8-Anilinonaphthalene-1-sulfonic acid ammonium salt, 98%
CAS:Fluorescent probe for proteins on polyacrylamide gelsFormula:C16H16N2O3SPurity:98%Color and Shape:Powder or crystalline powder, Straw yellow or green to dark greenMolecular weight:316.381-Naphthalenesulfonic acid, 8-(phenylamino)-, ammonium salt (1:1)
CAS:Formula:C16H16N2O3SPurity:97%Color and Shape:SolidMolecular weight:316.3748Ammonium 8-(Phenylamino)Naphthalene-1-Sulfonate
CAS:Ammonium 8-(Phenylamino)Naphthalene-1-SulfonatePurity:98%Molecular weight:316.37g/mol8-Anilino-1-naphthalenesulfonic acid ammonium salt
CAS:Formula:C16H13NO3S·NH3Purity:≥ 95.0%Color and Shape:Off-white to dark green-gray powderMolecular weight:316.37ANS-NH4 (=Ammonium 8-Anilino-1-naphthalenesulfonate) [Hydrophobic fluorescent probe]
CAS:Formula:C16H16N2O3SPurity:>95.0%(T)(HPLC)Color and Shape:Light yellow to Amber to Dark green powder to crystalMolecular weight:316.388-Anilino-1-naphthalenesulfonic acid,ammonium salt
CAS:M02698 - 8-Anilino-1-naphthalenesulfonic acid,ammonium salt
Formula:C16H16N2O3SPurity:95+%Color and Shape:SolidMolecular weight:316.38000488281258-Anilinonaphthalene-1-sulfonic acid ammonium salt
CAS:Fluorophore used to study molecular assemblies of surfactants and amphiphilesFormula:C16H16N2O3SPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:316.4 g/mol






