CymitQuimica logo

CAS 288385-89-7

:

4-fluoro-5-methoxy-1H-indole

Description:
4-Fluoro-5-methoxy-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the aromatic system. The fluorine substituent can enhance the compound's stability and influence its reactivity, while the methoxy group may participate in hydrogen bonding and affect its electronic properties. 4-Fluoro-5-methoxy-1H-indole is of interest in medicinal chemistry and research due to its potential biological activities, including interactions with various biological targets. Its synthesis and characterization are important for exploring its applications in pharmaceuticals and materials science. As with many indole derivatives, it may exhibit interesting pharmacological properties, making it a subject of study in drug development and chemical biology.
Formula:C9H8FNO
InChI:InChI=1/C9H8FNO/c1-12-8-3-2-7-6(9(8)10)4-5-11-7/h2-5,11H,1H3
InChI key:LWOWATBDWFGYLE-UHFFFAOYSA-N
SMILES:COc1ccc2c(cc[nH]2)c1F
Synonyms:
  • 1H-indole, 4-fluoro-5-methoxy-
  • 4-Fluoro-5-methoxy-1H-indole
Found 5 products.