CAS 288399-19-9

4-(chloromethyl)-2-methylquinoline

Description:

4-(Chloromethyl)-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chloromethyl group at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is soluble in organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The chloromethyl group can participate in nucleophilic substitution reactions, allowing for further functionalization. Additionally, the quinoline moiety is known for its potential applications in pharmaceuticals, agrochemicals, and as a fluorescent probe. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 4-(chloromethyl)-2-methylquinoline is a versatile compound with significant implications in various chemical research fields.

Formula: C₁₁H₁₀ClN

InChI: InChI=1/C11H10ClN/c1-8-6-9(7-12)10-4-2-3-5-11(10)13-8/h2-6H,7H2,1H3

SMILES: Cc1cc(CCl)c2ccccc2n1

Synonyms:

• Quinoline, 4-(chloromethyl)-2-methyl-
• 4-(Chloromethyl)-2-methylquinoline
• Quinoline, 4-(chloromethyl)-2-methyl- (9CI)
• 4-(Chloromethyl)-2-methyl-1-azanaphthalene

Quinoline, 4-(chloromethyl)-2-methyl-

CAS: 288399-19-9

Formula: C₁₁H₁₀ClN

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.6568

Ref: IN-DA002WQZ

4-(Chloromethyl)-2-methylquinoline

CAS: 288399-19-9

4-(Chloromethyl)-2-methylquinoline

Purity: 95%

Molecular weight: 191.66g/mol

Ref: 54-OR16603

4-Chloromethyl-2-methylquinoline

CAS: 288399-19-9

Formula: C₁₁H₁₀ClN

Purity: 98%

Color and Shape: No data available.

Molecular weight: 191.66

Ref: 10-F036022