CAS 2884-13-1
:2-Methyl-6-(methylthio)pyrazine
Description:
2-Methyl-6-(methylthio)pyrazine is an organic compound characterized by its pyrazine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a methyl group and a methylthio group attached to the pyrazine ring, contributing to its unique chemical properties and reactivity. It is typically a colorless to pale yellow liquid with a strong, distinctive odor, often described as earthy or roasted, making it of interest in flavor and fragrance applications. The presence of the methylthio group enhances its sulfurous notes, which can be desirable in certain culinary contexts. 2-Methyl-6-(methylthio)pyrazine is soluble in organic solvents and has limited solubility in water, reflecting its hydrophobic nature. It is stable under normal conditions but may undergo reactions typical of compounds containing sulfur and nitrogen, such as oxidation or substitution reactions. This compound is utilized in the food industry for flavoring and is also studied for its potential applications in various chemical syntheses and materials science.
Formula:C6H8N2S
InChI:InChI=1S/C6H8N2S/c1-5-3-7-4-6(8-5)9-2/h3-4H,1-2H3
InChI key:InChIKey=UWZQTYQYHJLIRS-UHFFFAOYSA-N
SMILES:S(C)C1=NC(C)=CN=C1
Synonyms:- 2-Methyl-6-(methylthio)pyrazine
- 2-Methyl-6-methylsulfanylpyrazine
- 2-Methylthio-6-methylpyrazine
- Pyrazine, 2-methyl-6-(methylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Methyl-6-(methylthio)pyrazine
CAS:Controlled Product<p>Applications 2-Methyl-6-(methylthio)pyrazine (cas# 2884-13-1) is a useful research chemical.<br></p>Formula:C6H8N2SColor and Shape:NeatMolecular weight:140.206

