CAS 288401-63-8
:4-Fluoro-2-(1-phenyl-1H-pyrazol-5-yl)phenol
Description:
4-Fluoro-2-(1-phenyl-1H-pyrazol-5-yl)phenol, with the CAS number 288401-63-8, is an organic compound characterized by its complex structure that includes a phenolic group and a pyrazole moiety. This compound features a fluorine atom substituted at the para position of the phenol ring, which can influence its reactivity and biological activity. The presence of the pyrazole ring, which is known for its diverse pharmacological properties, suggests potential applications in medicinal chemistry. The compound is likely to exhibit moderate to high solubility in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the phenyl and pyrazole groups. Additionally, the compound may display interesting electronic properties due to the electron-withdrawing effect of the fluorine atom, which can affect its interaction with biological targets. Overall, 4-Fluoro-2-(1-phenyl-1H-pyrazol-5-yl)phenol represents a valuable structure for further research in drug development and material science.
Formula:C15H11FN2O
InChI:InChI=1S/C15H11FN2O/c16-11-6-7-15(19)13(10-11)14-8-9-17-18(14)12-4-2-1-3-5-12/h1-10,19H
InChI key:InChIKey=QKFMBJCBTUKIEZ-UHFFFAOYSA-N
SMILES:OC1=C(C=2N(N=CC2)C3=CC=CC=C3)C=C(F)C=C1
Synonyms:- 4-Fluoro-2-(1-Phenyl-1H-Pyrazol-5-Yl)Phenol
- 5-(5-Fluoro-2-Hydroxyphenyl)-1-Phenylpyrazole
- Phenol, 4-fluoro-2-(1-phenyl-1H-pyrazol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
