
CAS 28841-62-5
:α-Trinositol
Description:
α-Trinositol, with the CAS number 28841-62-5, is a naturally occurring carbohydrate belonging to the inositol family. It is a stereoisomer of inositol, specifically a form of myo-inositol, and is characterized by its six-membered ring structure containing six hydroxyl (-OH) groups, which contribute to its solubility in water and its role in various biological processes. This compound is often found in plant sources and is involved in cellular signaling pathways, particularly in the regulation of insulin and glucose metabolism. α-Trinositol is recognized for its potential health benefits, including its role in promoting metabolic health and its use in dietary supplements. Additionally, it exhibits properties that may support nerve function and cognitive health. The compound is generally considered safe for consumption, but as with any supplement, it is advisable to consult with a healthcare professional before use. Its stability and reactivity are influenced by environmental factors such as pH and temperature, which can affect its biological activity.
Formula:C6H15O15P3
InChI:InChI=1S/C6H15O15P3/c7-1-2(8)4(19-22(10,11)12)6(21-24(16,17)18)5(3(1)9)20-23(13,14)15/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2-,3+,4-,5-,6-/m1/s1
InChI key:InChIKey=GKDKOMAJZATYAY-UOTPTPDRSA-N
SMILES:O(P(=O)(O)O)[C@H]1[C@H](OP(=O)(O)O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1OP(=O)(O)O
Synonyms:- PP 56
- Inositol, 1,2,6-tris(dihydrogen phosphate), D-myo-
- D-myo-1,2,6-Inositol trisphosphate
- D-myo-Inositol, 1,2,6-tris(dihydrogen phosphate)
- D-myo-Inositol 1,2,6-triphosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Atrinositol
CAS:Atrinositol improves energy homeostasis in a mouse model of pancreatic cancer.Formula:C6H15O15P3Color and Shape:SolidMolecular weight:420.1Ref: 4Z-I-249
Discontinued product

