CAS 2885-79-2
:N-propanoyl-L-cysteine
Description:
N-propanoyl-L-cysteine is a derivative of the amino acid cysteine, characterized by the presence of a propanoyl group attached to the amino acid's thiol side chain. This compound is notable for its potential biological activities, including antioxidant properties due to the presence of the thiol group, which can participate in redox reactions. It is typically a white to off-white solid and is soluble in polar solvents, reflecting the hydrophilic nature of its amino acid structure. The presence of the propanoyl group may influence its reactivity and interactions with other biomolecules. N-propanoyl-L-cysteine can be used in various biochemical applications, including studies related to protein synthesis and enzyme activity, as well as potential therapeutic roles in mitigating oxidative stress. Its CAS number, 2885-79-2, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, N-propanoyl-L-cysteine serves as an important compound in both research and potential therapeutic contexts.
Formula:C6H11NO3S
InChI:InChI=1/C6H11NO3S/c1-2-5(8)7-4(3-11)6(9)10/h4,11H,2-3H2,1H3,(H,7,8)(H,9,10)/t4-/m0/s1
SMILES:CCC(=N[C@@H](CS)C(=O)O)O
Synonyms:- L-Cysteine, N-(1-oxopropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(R)-3-Mercapto-2-propionamidopropanoic acid
CAS:Formula:C6H11NO3SPurity:98%Color and Shape:SolidMolecular weight:177.2214(R)-3-Mercapto-2-propionamidopropanoic acid
CAS:(R)-3-Mercapto-2-propionamidopropanoic acidPurity:98%Molecular weight:177.22g/molN-Propionyl-L-cysteine
CAS:Controlled ProductFormula:C6H11NO3SColor and Shape:NeatMolecular weight:177.22N-Propionyl-L-cysteine
CAS:Controlled ProductApplications It is used as a reducing agent for hair in permanent waves. It does not damage the hair (as thioglycolic acid does); it is nontoxic, and does not harm the eyes or the mucous membranes.
References Batterham, M., et al.: Eur. J. Clin. Nutrition, 55, 107Formula:C6H11NO3SColor and Shape:NeatMolecular weight:177.22




