CAS 288628-05-7
:6,7,8,9,10,11-Hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl sulfamate
Description:
6,7,8,9,10,11-Hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl sulfamate is a chemical compound characterized by its complex bicyclic structure, which includes a fused cycloheptane and a benzene ring. The presence of a sulfamate group indicates that it contains a sulfur atom bonded to an oxygen atom and a nitrogen atom, contributing to its potential reactivity and biological activity. This compound is likely to exhibit properties typical of sulfamates, such as being a potential inhibitor or modulator in various biochemical pathways. Its hexahydro structure suggests it is saturated, which may influence its solubility and stability in different solvents. The oxo group in the structure implies the presence of a carbonyl functionality, which can participate in various chemical reactions, including nucleophilic attacks. Overall, the unique structural features of this compound may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C14H15NO5S
InChI:InChI=1S/C14H15NO5S/c15-21(17,18)20-9-6-7-11-10-4-2-1-3-5-12(10)14(16)19-13(11)8-9/h6-8H,1-5H2,(H2,15,17,18)
InChI key:InChIKey=DSLPMJSGSBLWRE-UHFFFAOYSA-N
SMILES:O=C1C2=C(C=3C(=CC(OS(N)(=O)=O)=CC3)O1)CCCCC2
Synonyms:- 6,7,8,9,10,11-Hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl sulfamate
- 667-Coumate
- Bn 83495
- Irosustat
- Stx 64
- Sulfamic acid, 6,7,8,9,10,11-hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Sulfamic acid, 6,7,8,9,10,11-hexahydro-6-oxobenzo[b]cyclohepta[d]pyran-3-yl ester
CAS:Formula:C14H15NO5SPurity:98%Color and Shape:SolidMolecular weight:309.3376Irosustat
CAS:Irosustat (667-Coumate) is a potent steroid sulfatase inhibitor, with an IC50 of 8 nM, and exhibits anti-breast cancer activity.Formula:C14H15NO5SPurity:99.33%Color and Shape:SolidMolecular weight:309.34Ref: TM-T4464
2mg35.00€5mg51.00€10mg88.00€25mg170.00€50mg278.00€100mg396.00€200mg563.00€1mL*10mM (DMSO)52.00€STX64
CAS:STX64 is an inhibitor of sulfatase, a class of enzymes that catalyzes the hydrolysis of sulfate esters. It has been shown to inhibit cancer cells in vitro and in vivo. STX64 also inhibits steroid sulfatase, which is an enzyme that catalyzes the conversion of steroids to inactive metabolites. This drug has a potential for use as a chemotherapeutic agent for breast cancer. STX64 binds to the active site of the enzyme and prevents other molecules from binding, thereby preventing the conversion process. STX64 may be used in combination with other drugs to prevent drug interactions by inhibiting their metabolism.
Formula:C14H15NO5SPurity:Min. 95%Molecular weight:309.34 g/molRef: 3D-NLA62805
Discontinued product





