CAS 28867-76-7
:trans,trans-Benzaldehyde azine
Description:
Trans,trans-Benzaldehyde azine is an organic compound characterized by its azine functional group, which is formed from the condensation of benzaldehyde and hydrazine. This compound typically appears as a colorless to pale yellow liquid and is known for its distinct aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic benzene ring. The structure of trans,trans-Benzaldehyde azine features a central azine linkage (–N=N–) connecting two benzaldehyde moieties, which contributes to its stability and reactivity. This compound can participate in various chemical reactions, including oxidation and reduction, and is often utilized in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Additionally, it may exhibit interesting properties such as fluorescence or photochemical behavior, making it a subject of interest in research and industrial applications. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C14H12N2
InChI:InChI=1/C14H12N2/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14/h1-12H/b15-11+,16-12+
Synonyms:- trans,trans-Benzalazine
- (1E,2E)-bis(phenylmethylidene)hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
