CymitQuimica logo

CAS 28871-95-6

:

endo-2,3-Norbornanedicarboximide

Description:
Endo-2,3-Norbornanedicarboximide, identified by its CAS number 28871-95-6, is a bicyclic compound characterized by its unique norbornane structure, which features a fused cyclobutane and cyclopentane ring system. This compound contains two carboximide functional groups, which contribute to its chemical reactivity and potential applications in various fields, including materials science and organic synthesis. The endo configuration indicates that the substituents are oriented towards the interior of the bicyclic system, influencing its steric and electronic properties. Typically, compounds like endo-2,3-Norbornanedicarboximide exhibit good thermal stability and can participate in various chemical reactions, such as cycloadditions and polymerizations. Its solubility is generally moderate in organic solvents, making it suitable for use in diverse chemical environments. Additionally, the presence of the carboximide groups can enhance its interactions with other molecules, potentially leading to applications in drug delivery or as intermediates in the synthesis of more complex organic compounds. Overall, endo-2,3-Norbornanedicarboximide is a versatile compound with significant implications in both academic research and industrial applications.
Formula:C9H11NO2
InChI:InChI=1S/C9H11NO2/c11-8-6-4-1-2-5(3-4)7(6)9(12)10-8/h4-7H,1-3H2,(H,10,11,12)/t4-,5+,6-,7+
InChI key:RIVOBMOBWMOLDJ-UMRXKNAASA-N
SMILES:C1C[C@H]2C[C@@H]1[C@@H]3[C@H]2C(=O)NC3=O
Found 6 products.