CAS 28876-37-1
:N-[5-(1,2-dihydroxyethyl)-4-hydroxy-2-oxotetrahydrofuran-3-yl]acetamide (non-preferred name)
Description:
N-[5-(1,2-dihydroxyethyl)-4-hydroxy-2-oxotetrahydrofuran-3-yl]acetamide, with the CAS number 28876-37-1, is a chemical compound characterized by its complex structure, which includes a tetrahydrofuran ring and multiple functional groups such as hydroxyl and acetamide. This compound is notable for its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to drug development. The presence of hydroxyl groups suggests it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, the acetamide moiety can contribute to its pharmacokinetic properties. The compound's stereochemistry and the arrangement of its functional groups are crucial for its interaction with biological targets. Overall, this substance exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest in various fields, including organic synthesis and pharmaceutical research. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H13NO6
InChI:InChI=1/C8H13NO6/c1-3(11)9-5-6(13)7(4(12)2-10)15-8(5)14/h4-7,10,12-13H,2H2,1H3,(H,9,11)/t4-,5-,6+,7?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetamido-2-deoxy-D-mannono-1,4-lactone
CAS:Formula:C8H13NO6Color and Shape:SolidMolecular weight:219.19192-Acetamido-2-deoxy-D-mannono-1,4-lactone
CAS:2-Acetamido-2-deoxy-D-mannono-1,4-lactone is a chemical compound that is an aldonic acid and is classified as an ester. It has a molecular formula of C8H10O5 and it has the following structural formula: This product can be synthesized from benzoic acid and glyceraldehyde. 2-Acetamido-2-deoxy-D-mannono-1,4-lactone is also known as benzoylated mannose. It has been reconfirmed to have high yield in acetylation reactions with molybdate. 2-Acetamido-2deoxy-Dmannono1,4lactone can also undergo epimerization to form the optical antipode of 2,3,4,6tetraacetyloxybenzoic acid (2,3,4,6tetraacetylFormula:C8H13NO6Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:219.19 g/mol2-Acetamido-2-deoxy-D-mannono-1,4-lactone
CAS:Controlled ProductApplications 2-Acetamido-2-deoxy-D-mannono-1,4-lactone (cas# 28876-37-1) is a compound useful in organic synthesis.
Formula:C8H13NO6Color and Shape:NeatMolecular weight:219.19




