CAS 288853-63-4
:6-[(2-{4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy}ethyl)(methyl)amino]pyridin-3-yl hydrogen sulfate
Description:
The chemical substance known as "6-[(2-{4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy}ethyl)(methyl)amino]pyridin-3-yl hydrogen sulfate" with CAS number 288853-63-4 is a complex organic compound characterized by its multi-functional structure. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with various functional groups, including a thiazolidinone moiety, which contributes to its potential biological activity. The presence of a hydrogen sulfate group indicates that it may exhibit acidic properties, which can influence its solubility and reactivity in different environments. This compound is likely to be of interest in medicinal chemistry due to its intricate structure, which may interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties could be explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, this compound exemplifies the complexity often found in pharmaceutical agents, highlighting the interplay between structure and function in drug design.
Formula:C18H19N3O7S2
InChI:InChI=1/C18H19N3O7S2/c1-21(16-7-6-14(11-19-16)28-30(24,25)26)8-9-27-13-4-2-12(3-5-13)10-15-17(22)20-18(23)29-15/h2-7,11,15H,8-10H2,1H3,(H,20,22,23)(H,24,25,26)
SMILES:CN(CCOc1ccc(cc1)CC1C(=NC(=O)S1)O)c1ccc(cn1)OS(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,4-Thiazolidinedione, 5-[[4-[2-[methyl[5-(sulfooxy)-2-pyridinyl]amino]ethoxy]phenyl]methyl]-
CAS:Formula:C18H19N3O7S2Color and Shape:SolidMolecular weight:453.48945-Hydroxy Rosiglitazone Sulfate
CAS:Controlled ProductStability Hygroscopic
Applications A metabolite of Rosiglitazone.
References Balton, G.C., et al.: Xenobiotica, 26, 6, 627 (1996),Formula:C18H19N3O7S2Color and Shape:NeatMolecular weight:453.49

