CAS 2889-31-8
:(±)-2-Hydroxyglutaric acid
Description:
(±)-2-Hydroxyglutaric acid, with the CAS number 2889-31-8, is a chiral organic compound that serves as a significant intermediate in various biochemical pathways. It is a dicarboxylic acid, characterized by the presence of two carboxyl functional groups (-COOH) and a hydroxyl group (-OH) attached to a five-carbon chain. This compound exists in two enantiomeric forms, which can exhibit different biological activities and properties. (±)-2-Hydroxyglutaric acid is soluble in water and polar organic solvents, making it useful in various chemical reactions and applications. It plays a role in cellular metabolism, particularly in the context of the citric acid cycle and is implicated in certain metabolic disorders. Additionally, its derivatives and analogs are of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. The compound's stability, reactivity, and interactions with other biomolecules contribute to its significance in both biological and chemical research contexts.
Formula:C5H8O5
InChI:1S/C5H8O5/c6-3(5(9)10)1-2-4(7)8/h3,6H,1-2H2,(H,7,8)(H,9,10)/p-2
InChI key:InChIKey=HWXBTNAVRSUOJR-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(C(O)=O)O
Synonyms:- (±)-2-Hydroxyglutaric acid
- 2,3-Dideoxypentaric acid
- 2-Hydroxyglutaricacid
- 2-Hydroxypentanedioic acid
- <span class="text-smallcaps">DL</span>-2-Hydroxyglutaric acid
- DL-2-Hydroxyglutaric acid
- Glutaric acid, 2-hydroxy-
- Glutaricacid, 2-hydroxy- (6CI,7CI,8CI)
- Pentanedioic acid,2-hydroxy-
- a-Hydroxyglutaric acid
- C02630
- alpha-hydroxyglutarate
- 2-hydroxyglutarate
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
α-Hydroxyglutaric Acid
CAS:α-Hydroxyglutaric Acid is a natural product for research related to life sciences. The catalog number is T36624 and the CAS number is 2889-31-8.Formula:C5H8O5Color and Shape:SolidMolecular weight:148.1142-Hydroxyglutarate-13C5,d8
CAS:Controlled ProductFormula:C5D8O5Color and Shape:NeatMolecular weight:161.127

