CAS 28899-75-4

7-Chloro-1H-indole-2-carboxylic acid

Description:

7-Chloro-1H-indole-2-carboxylic acid is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 7-position and a carboxylic acid group at the 2-position contributes to its unique chemical properties. This compound typically appears as a solid and is soluble in polar solvents, reflecting its functional groups. It exhibits acidic behavior due to the carboxylic acid moiety, which can donate protons in solution. The chlorine substituent can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Additionally, 7-Chloro-1H-indole-2-carboxylic acid may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry. Its structural features and reactivity profile make it a useful building block in the synthesis of more complex molecules.

Formula: C₉H₆ClNO₂

InChI: InChI=1S/C9H6ClNO2/c10-6-3-1-2-5-4-7(9(12)13)11-8(5)6/h1-4,11H,(H,12,13)

InChI key: InChIKey=NVKAHBFPKVINGE-UHFFFAOYSA-N

SMILES: ClC1=C2C(C=C(C(O)=O)N2)=CC=C1

Synonyms:

• 1H-Indole-2-carboxylic acid, 7-chloro-
• 7-Chloro-2-indolecarboxylic acid
• 7-Chloroindole-2-carboxylic acid
• Indole-2-carboxylic acid, 7-chloro-
• 7-Chloro-1H-indole-2-carboxylic acid

1H-Indole-2-carboxylic acid, 7-chloro-

CAS: 28899-75-4

Formula: C₉H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 195.6024

Ref: IN-DA002WZB

7-Chloro-1H-indole-2-carboxylic acid

CAS: 28899-75-4

7-Chloro-1H-indole-2-carboxylic acid

Purity: 97%

Molecular weight: 195.60g/mol

Ref: 54-OR906974

7-Chloro-1H-indole-2-carboxylic acid

CAS: 28899-75-4

Formula: C₉H₆ClNO₂

Purity: 95%

Color and Shape: Solid, Light yellow powder

Molecular weight: 195.6

Ref: 10-F222439