CAS 28903-71-1: Cobalt tetramethoxyphenylporphyrin
Description:Cobalt tetramethoxyphenylporphyrin is a coordination compound featuring cobalt as the central metal ion coordinated to a porphyrin ligand that is substituted with four methoxyphenyl groups. This compound is characterized by its distinct porphyrin structure, which consists of a large, planar, cyclic arrangement of carbon and nitrogen atoms, allowing for effective coordination with the cobalt ion. The presence of methoxy groups enhances the solubility of the compound in organic solvents and can influence its electronic properties. Cobalt tetramethoxyphenylporphyrin exhibits interesting optical and electrochemical properties, making it useful in various applications, including catalysis, sensors, and as a model for studying metalloporphyrin behavior in biological systems. Additionally, its stability and reactivity can be influenced by the nature of the substituents on the porphyrin ring, which can affect its interaction with other molecules. Overall, this compound serves as an important example of metalloporphyrins in coordination chemistry and materials science.
Formula:C48H36CoN4O4
InChI:InChI=1/C48H36N4O4.Co/c1-53-33-13-5-29(6-14-33)45-37-21-23-39(49-37)46(30-7-15-34(54-2)16-8-30)41-25-27-43(51-41)48(32-11-19-36(56-4)20-12-32)44-28-26-42(52-44)47(40-24-22-38(45)50-40)31-9-17-35(55-3)18-10-31;/h5-28H,1-4H3;/q-2;+2/b45-37-,45-38-,46-39-,46-41-,47-40-,47-42-,48-43-,48-44-;
- Synonyms:
- 21H,23H-porphine, 5,10,15,20-tetrakis(4-methoxyphenyl)-, cobalt(2+) salt (1:1)
- Cobalt(2+) 5,10,15,20-Tetrakis(4-Methoxyphenyl)Porphine-21,23-Diide
- Tetrakis(4-Methoxyphenyl)-21H,23H-Porphine Cobalt(Ii)