CymitQuimica logo

CAS 289039-20-9

:

5-Bromo-2-iodobenzamide

Description:
5-Bromo-2-iodobenzamide is an organic compound characterized by the presence of both bromine and iodine substituents on a benzene ring, specifically at the 5 and 2 positions, respectively. This compound features an amide functional group, which contributes to its chemical reactivity and solubility properties. It is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. The presence of halogens (bromine and iodine) can influence its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and material science. The compound may also exhibit unique physical properties, such as specific melting and boiling points, and can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug development. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures should be followed.
Formula:C7H5BrINO
InChI:InChI=1S/C7H5BrINO/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H2,10,11)
InChI key:InChIKey=PSQDNPRLSXTGEU-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(I)C=CC(Br)=C1
Synonyms:
  • 5-Bromo-2-Iodobenzamide
  • Benzamide, 5-Bromo-2-Iodo-
Found 5 products.