CAS 289039-51-6
:Benzamide, 3,5-dibromo-4-methyl-
Description:
Benzamide, 3,5-dibromo-4-methyl- is an organic compound characterized by the presence of a benzene ring substituted with a carboxamide group and multiple halogen atoms. Specifically, it features two bromine atoms located at the 3 and 5 positions and a methyl group at the 4 position of the benzene ring. This compound is a derivative of benzamide, which is known for its applications in organic synthesis and as a building block in pharmaceuticals. The presence of bromine atoms enhances its reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. The methyl group contributes to the compound's overall hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the molecular structure suggests potential applications in agrochemicals and materials science. As with many brominated compounds, considerations regarding environmental impact and toxicity are important, necessitating careful handling and assessment in research and industrial contexts.
Formula:C8H7Br2NO
InChI:InChI=1S/C8H7Br2NO/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3H,1H3,(H2,11,12)
InChI key:InChIKey=ISHWDFOFBAHPLV-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC(Br)=C(C)C(Br)=C1
Synonyms:- 3,5-Dibromo-4-methylbenzamide
- Benzamide, 3,5-dibromo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3,5-Dibromo-4-methylbenzamide
CAS:<p>3,5-Dibromo-4-methylbenzamide</p>Purity:techMolecular weight:292.96g/mol
