CAS 289039-81-2
:2-Fluoro-4-(1-methylethoxy)benzoic acid
Description:
2-Fluoro-4-(1-methylethoxy)benzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and an ether functional group. The molecular structure features a benzoic acid core, which is a benzene ring substituted with a carboxylic acid group (-COOH) and a 1-methylethoxy group, contributing to its unique properties. The fluorine substitution at the 2-position of the benzene ring can influence the compound's reactivity, polarity, and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the aromatic ring and the ether group. Its acidic nature is attributed to the carboxylic acid functional group, which can donate protons in solution. The presence of the fluorine atom may enhance the compound's stability and lipophilicity, making it of interest in pharmaceutical and agrochemical applications. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and environmental impact.
Formula:C10H11FO3
InChI:InChI=1S/C10H11FO3/c1-6(2)14-7-3-4-8(10(12)13)9(11)5-7/h3-6H,1-2H3,(H,12,13)
InChI key:InChIKey=LFYMPARUPZDGHJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C=C(OC(C)C)C=C1
Synonyms:- 2-Fluoro-4-(propan-2-yloxy)benzoic acid
- 2-Fluoro-4-iso-propyloxybenzoic acid
- 2-Fluoro-4-isopropoxybenzoic acid
- Benzoic Acid, 2-Fluoro-4-(1-Methylethoxy)-
- 2-Fluoro-4-(1-methylethoxy)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-4-isopropoxybenzoic acid
CAS:<p>2-Fluoro-4-isopropoxybenzoic acid</p>Purity:97%Molecular weight:198.19g/mol2-Fluoro-4-isopropyloxybenzoic acid
CAS:<p>2-Fluoro-4-isopropyloxybenzoic acid is a fluorescent reagent with a high quality and purity. It is a complex compound that can be used as an intermediate in the synthesis of fine chemicals, pharmaceuticals, pesticides, herbicides, and other useful compounds. 2-Fluoro-4-isopropyloxybenzoic acid is also used as a starting material for the synthesis of speciality chemicals such as reaction components and versatile building blocks. It is soluble in organic solvents and has been shown to react with various functional groups.</p>Formula:C10H11FO3Purity:Min. 95%Color and Shape:White PowderMolecular weight:198.19 g/mol



