CAS 289039-82-3

Benzoic acid, 5-chloro-2-iodo-, methyl ester

Description:

Benzoic acid, 5-chloro-2-iodo-, methyl ester, with the CAS number 289039-82-3, is an organic compound characterized by the presence of a benzoic acid moiety modified by the substitution of chlorine and iodine atoms at specific positions on the aromatic ring. This compound features a methyl ester functional group, which contributes to its solubility and reactivity. Typically, such esters exhibit moderate polarity, allowing them to dissolve in organic solvents while having limited solubility in water. The presence of halogen substituents, specifically chlorine and iodine, can influence the compound's reactivity, stability, and potential applications in organic synthesis or as intermediates in pharmaceuticals. Additionally, the halogen atoms may impart unique properties, such as increased lipophilicity or altered electronic characteristics, which can affect the compound's behavior in biological systems. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science, due to its structural features and potential reactivity.

Formula: C₈H₆ClIO₂

InChI: InChI=1S/C8H6ClIO2/c1-12-8(11)6-4-5(9)2-3-7(6)10/h2-4H,1H3

InChI key: InChIKey=LNCNRPALSKTJBG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(I)C=CC(Cl)=C1

Synonyms:

• 5-Chloro-2-iodobenzoic acid methyl ester
• Benzoic Acid, 5-Chloro-2-Iodo-, Methyl Ester
• Methyl 5-chloro-2-iodobenzoate
• Methyl 5-chloro-2-iodobenzoate

Benzoic acid, 5-chloro-2-iodo-, methyl ester

CAS: 289039-82-3

Formula: C₈H₆ClIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 296.4895

Ref: IN-DA002X0Y

5-Chloro-2-iodobenzoic acid methyl ester

CAS: 289039-82-3

5-Chloro-2-iodobenzoic acid methyl ester

Purity: 98%

Molecular weight: 296.49g/mol

Ref: 54-OR80504

Methyl 5-chloro-2-iodobenzoate

CAS: 289039-82-3

Formula: C₈H₆ClIO₂

Purity: 96%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 296.49

Ref: 10-F098313