CAS 28917-43-3: 3,5-Bis(phenylmethoxy)benzoic acid
Description:3,5-Bis(phenylmethoxy)benzoic acid, with the CAS number 28917-43-3, is an organic compound characterized by its structure, which features a benzoic acid core substituted at the 3 and 5 positions with phenylmethoxy groups. This compound typically exhibits properties associated with aromatic compounds, including a relatively high melting point and low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. The presence of the carboxylic acid functional group contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the phenylmethoxy substituents can influence the compound's reactivity and stability, potentially enhancing its lipophilicity and affecting its biological activity. This compound may find applications in organic synthesis, pharmaceuticals, or as a building block in materials science due to its unique structural features. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and reactivity.
Formula:C21H18O4
InChI:InChI=1S/C21H18O4/c22-21(23)18-11-19(24-14-16-7-3-1-4-8-16)13-20(12-18)25-15-17-9-5-2-6-10-17/h1-13H,14-15H2,(H,22,23)
InChI key:InChIKey=DHQIBPUGSWVDOH-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(OCC=2C=CC=CC2)C=C(OCC=3C=CC=CC3)C1
- Synonyms:
- 3,5-Benzyloxybenzoic acid
- 3,5-Bis(Benzyloxy)Benzoic Acid
- 3,5-Bis(phenylmethoxy)benzoic acid
- 3,5-Dibenzyloxybenzoic acid
- 3,5-Diphenoxybenzoic Acid
- Benzoic acid, 3,5-bis(benzyloxy)-
- Benzoic acid, 3,5-bis(phenylmethoxy)-
- NSC 210283
