CAS 28921-30-4

1-(4-chlorophenyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

Description:

1-(4-Chlorophenyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, with the CAS number 28921-30-4, is a heterocyclic compound characterized by its pyrimidine core, which features a thioxo group and a chlorophenyl substituent. This compound typically exhibits a solid state at room temperature and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the thioxo group contributes to its reactivity and may influence its interaction with biological targets. The chlorophenyl moiety can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and bioavailability. Additionally, the compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in drug development. Its structural features suggest that it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Overall, this compound represents a class of thioxodihydropyrimidines that are valuable in the exploration of new therapeutic agents.

Formula: C₁₀H₇ClN₂O₂S

InChI: InChI=1/C10H7ClN2O2S/c11-6-1-3-7(4-2-6)13-9(15)5-8(14)12-10(13)16/h1-4H,5H2,(H,12,14,16)

SMILES: c1cc(ccc1Cl)N1C(=O)CC(=NC1=S)O

1-(4-Chlorophenyl)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione

CAS: 28921-30-4

Versatile small molecule scaffold

Formula: C₁₀H₇ClN₂O₂S

Purity: Min. 95%

Molecular weight: 254.69 g/mol

Ref: 3D-DBA92130