
CAS 28937-85-1
:3-Acetylaleuritolic acid
Description:
3-Acetylaleuritolic acid is a naturally occurring compound classified as a triterpenoid, specifically a type of pentacyclic triterpene. It is derived from various plant sources, particularly those in the family Euphorbiaceae. This compound is characterized by its unique chemical structure, which includes a hydroxyl group and an acetyl group, contributing to its biological activity. 3-Acetylaleuritolic acid has been studied for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. Its mechanism of action may involve modulation of various signaling pathways and inhibition of specific enzymes. Additionally, this compound exhibits low toxicity, making it a subject of interest in medicinal chemistry and natural product research. The presence of functional groups in its structure allows for various chemical reactions, which can be exploited for synthetic modifications or derivatization in laboratory settings. Overall, 3-acetylaleuritolic acid represents a significant compound in the study of natural products and their therapeutic potentials.
Formula:C32H50O4
InChI:InChI=1S/C32H50O4/c1-20(33)36-25-12-15-29(6)21(28(25,4)5)9-13-30(7)22(29)10-14-31(8)23(30)11-16-32(26(34)35)18-17-27(2,3)19-24(31)32/h11,21-22,24-25H,9-10,12-19H2,1-8H3,(H,34,35)/t21-,22+,24-,25-,29-,30+,31+,32+/m0/s1
InChI key:InChIKey=UROPGAQBZGIPQC-VUHMTIHWSA-N
SMILES:C[C@]12C([C@@]3(C)[C@](CC1)([C@]4(C)[C@@](CC3)(C(C)(C)[C@@H](OC(C)=O)CC4)[H])[H])=CC[C@]5(C(O)=O)[C@]2(CC(C)(C)CC5)[H]
Synonyms:- Acetylaleuritolic acid
- (3β,13α)-3-(Acetyloxy)-13-methyl-27-norolean-14-en-28-oic acid
- D-Friedoolean-14-en-28-oic acid, 3-(acetyloxy)-, (3β)-
- 27-Norolean-14-en-28-oic acid, 3-(acetyloxy)-13-methyl-, (3β,13α)-
- D-Friedoolean-14-en-28-oic acid, 3β-hydroxy-, acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Acetylaleuritolic acid
CAS:Acetylaleuritolic acid, a pentacyclic triterpenoid from Garcinia miniata leaves, inhibits P-388 leukemia.Formula:C32H50O4Color and Shape:SolidMolecular weight:498.74
