CAS 28945-89-3
:3-(3-ethoxyphenyl)propanoic acid
Description:
3-(3-Ethoxyphenyl)propanoic acid, identified by the CAS number 28945-89-3, is an organic compound characterized by its propanoic acid backbone substituted with a 3-ethoxyphenyl group. This compound typically exhibits properties associated with carboxylic acids, including the ability to form hydrogen bonds due to the presence of the carboxyl functional group (-COOH). It is likely to be a solid at room temperature, with moderate solubility in polar solvents like water, while being more soluble in organic solvents. The ethoxy group contributes to its hydrophobic character, influencing its overall solubility and reactivity. The compound may exhibit biological activity, potentially serving as an intermediate in organic synthesis or as a pharmaceutical agent, depending on its specific structural features and functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-2-14-10-5-3-4-9(8-10)6-7-11(12)13/h3-5,8H,2,6-7H2,1H3,(H,12,13)
SMILES:CCOc1cccc(CCC(=O)O)c1
Synonyms:- Benzenepropanoic acid, 3-ethoxy-
- 3-(3-Ethoxyphenyl)propanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-(3-Ethoxyphenyl)propionic acid
CAS:3-(3-Ethoxyphenyl)propionic acid is a useful building block in organic chemistry. It is used as a reagent in the synthesis of various pharmaceuticals, pesticides, and other chemicals. 3-(3-Ethoxyphenyl)propionic acid is also an intermediate in the production of 3-ethoxybenzoic acid and its derivatives.Formula:C11H14O3Purity:Min. 95%Color and Shape:PowderMolecular weight:194.23 g/mol3-(3-Ethoxyphenyl)propionic acid
CAS:Formula:C11H14O3Purity:97%Color and Shape:SolidMolecular weight:194.23




