CAS 289470-22-0
:6-iodonicotinonitrile
Description:
6-Iodonicotinonitrile is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both an iodine atom and a nitrile group. The presence of the iodine atom enhances its reactivity, making it a useful intermediate in various organic synthesis reactions. The nitrile group contributes to its polar nature, influencing its solubility in polar solvents. This compound is typically utilized in medicinal chemistry and material science due to its potential biological activity and ability to participate in further chemical transformations. Additionally, the presence of the nitrile functional group may impart specific electronic properties, making it valuable in the development of pharmaceuticals and agrochemicals. As with many halogenated compounds, safety precautions should be observed when handling 6-iodonicotinonitrile, as it may pose health risks. Overall, its distinctive features make it a compound of interest in both academic research and industrial applications.
Formula:C6H3IN2
InChI:InChI=1/C6H3IN2/c7-6-2-1-5(3-8)4-9-6/h1-2,4H
SMILES:c1cc(I)ncc1C#N
Synonyms:- 5-Cyano-2-iodopyridine
- 6-Iodonicotinolnitrile
- 6-Iodopyridine-3-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Pyridinecarbonitrile, 6-iodo-
CAS:Formula:C6H3IN2Purity:96%Color and Shape:SolidMolecular weight:230.00596-Iodonicotinonitrile
CAS:<p>6-Iodonicotinonitrile</p>Formula:C6H3IN2Purity:98%Color and Shape: yellow solidMolecular weight:230.01g/mol6-Iodonicotinonitrile
CAS:<p>Iodonicotinonitrile is a versatile and efficient regioselective coupling catalyst for the synthesis of substituted heteroaryl bromides. Iodonicotinonitrile converts potassium iodide to an iodonium salt with copper(I) chloride, which in turn reacts with aryl or heteroaryl bromides to give the desired products in high yields. The use of iodonicotinonitrile as a coupling agent provides advantages over other methods such as the addition of iodine to an aryl halide. The use of iodonicotinonitrile is advantageous because it can be used in both acidic and basic conditions and is also more efficient than other methods.</p>Formula:C6H3IN2Purity:Min. 95%Molecular weight:230 g/mol
