CAS 289472-80-6
:N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide
Description:
N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide, with the CAS number 289472-80-6, is a chemical compound characterized by its complex structure, which includes a pyrazine ring and an amide functional group. This compound features a chiral center, indicated by the (1S) configuration, which contributes to its potential biological activity and specificity in interactions with biological targets. The presence of the phenylmethyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The amino and carbonyl groups suggest that it may participate in hydrogen bonding, which can affect solubility and reactivity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods to determine purity, stability, and biological activity.
Formula:C14H14N4O2
InChI:InChI=1S/C14H14N4O2/c15-13(19)11(8-10-4-2-1-3-5-10)18-14(20)12-9-16-6-7-17-12/h1-7,9,11H,8H2,(H2,15,19)(H,18,20)/t11-/m0/s1
InChI key:InChIKey=KTQJEBWLYWKXRA-NSHDSACASA-N
SMILES:[C@H](NC(=O)C=1C=NC=CN1)(CC2=CC=CC=C2)C(N)=O
Synonyms:- (S)-N-(1-Amino-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxamide
- Pyrazinecarboxamide, N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-
- N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide
- 2-Pyrazinecarboxamide, N-[(1S)-2-amino-2-oxo-1-(phenylmethyl)ethyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Bortezomib Amide Analog (N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide)
CAS:Heterocyclic compounds with nitrogen hetero-atom(s) only, aromatic or modified aromatic, nesoiFormula:C14H14N4O2Color and Shape:White Off-White SolidMolecular weight:270.11168(S)-N-(1-Amino-1-oxo-3-phenylpropan-2-yl)pyrazine-2-carboxamide
CAS:Formula:C14H14N4O2Purity:95%Color and Shape:SolidMolecular weight:270.2866Bortezomib Impurity 3
CAS:Formula:C14H14N4O2Color and Shape:White To Off-White SolidMolecular weight:270.29Bortezomib Impurity 41
CAS:Formula:C14H14N4O2Color and Shape:White To Off-White SolidMolecular weight:270.29N-[(1S)-2-Amino-1-benzyl-2-oxoethyl]pyrazine-2-carboxamide
CAS:Controlled ProductFormula:C14H14N4O2Color and Shape:NeatMolecular weight:270.29N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide
CAS:Impurity Bortezomib USP Impurity B
Applications N-[(1S)-2-Amino-2-oxo-1-(phenylmethyl)ethyl]-2-pyrazinecarboxamide is a metabolite of Bortezomib (B675700), a proteasome inhibitor for the treatment of multiple myeloma and is known to also target the ubiquitin-proteasome pathway.
References Pekol, T., et al.: Drug. Meta. Disp., 33, 771 (2005); Hsieh, F.Y., et al.: J. Pharma. Biomed. Anal., 49, 115 (2009);Formula:C14H14N4O2Color and Shape:NeatMolecular weight:270.29






