CAS 28948-58-5

7-chlorothieno[2,3-c]pyridine

Description:

7-Chlorothieno[2,3-c]pyridine is a heterocyclic organic compound characterized by the presence of a thieno ring fused to a pyridine ring, with a chlorine substituent at the 7-position. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and ethanol, but may have limited solubility in water. The presence of the chlorine atom introduces unique electronic properties, influencing its reactivity and potential applications in medicinal chemistry and material science. 7-Chlorothieno[2,3-c]pyridine can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in the synthesis of more complex molecules. Its structural features may contribute to biological activity, and it has been studied for potential use in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many heterocycles, the compound's properties can be influenced by the presence of functional groups and the overall molecular environment.

Formula: C₇H₄ClNS

InChI: InChI=1/C7H4ClNS/c8-7-6-5(1-3-9-7)2-4-10-6/h1-4H

SMILES: c1cnc(c2c1ccs2)Cl

Synonyms:

• Thieno[2,3-C]Pyridine, 7-Chloro-
• 7-CHLORO-THIENO[2,3-C] PYRIDINE
• 7-Chlorothieno[2,3-c]pyri...

Thieno[2,3-c]pyridine, 7-chloro-

CAS: 28948-58-5

Formula: C₇H₄ClNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.6314

Ref: IN-DA002X61

7-Chlorothieno[2,3-c]pyridine

CAS: 28948-58-5

7-Chlorothieno[2,3-c]pyridine

Purity: 99%

Color and Shape: Solid

Molecular weight: 169.63g/mol

Ref: 54-OR480815

7-Chlorothieno[2,3-c]pyridine

CAS: 28948-58-5

Formula: C₇H₄ClNS

Purity: 97%

Color and Shape: Solid

Molecular weight: 169.63

Ref: 10-F092098

7-Chlorothieno[2,3-c]pyridine

CAS: 28948-58-5

Versatile small molecule scaffold

Formula: C₇H₄ClNS

Purity: Min. 95%

Molecular weight: 169.63 g/mol

Ref: 3D-DBA94858