CAS 289488-54-6

N-Butyl-3-methoxy-4-(phenylmethoxy)benzenemethanamine

Description:

N-Butyl-3-methoxy-4-(phenylmethoxy)benzenemethanamine, with the CAS number 289488-54-6, is a chemical compound that belongs to the class of substituted phenylamines. This substance features a butyl group, methoxy groups, and a phenylmethoxy moiety, contributing to its unique structural characteristics. It is likely to exhibit moderate lipophilicity due to the presence of the butyl and phenyl groups, which can influence its solubility in organic solvents. The methoxy groups may enhance its reactivity and potential interactions with biological targets. As a phenylamine derivative, it may also exhibit properties relevant to medicinal chemistry, such as potential activity as a neurotransmitter modulator or other pharmacological effects. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, which may affect its physical properties, such as melting point and boiling point. However, specific data on its toxicity, stability, and reactivity would require further investigation through experimental studies or literature review.

Formula: C₁₉H₂₅NO₂

InChI: InChI=1S/C19H25NO2/c1-3-4-12-20-14-17-10-11-18(19(13-17)21-2)22-15-16-8-6-5-7-9-16/h5-11,13,20H,3-4,12,14-15H2,1-2H3

InChI key: InChIKey=GHPXCAUHTSEKPF-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(OC)C=C(CNCCCC)C=C2

Synonyms:

• Benzenemethanamine, N-butyl-3-methoxy-4-(phenylmethoxy)-
• N-Butyl-3-methoxy-4-(phenylmethoxy)benzenemethanamine

{[4-(benzyloxy)-3-methoxyphenyl]methyl}(butyl)amine

CAS: 289488-54-6

Formula: C₁₉H₂₅NO₂

Purity: 95.0%

Molecular weight: 299.414

Ref: 10-F523105