CAS 289504-53-6

4-bromo-1-(4-chlorobenzyl)-1H-pyrazole-5-carbaldehyde

Description:

4-bromo-1-(4-chlorobenzyl)-1H-pyrazole-5-carbaldehyde is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a chlorobenzyl group at the 1-position contributes to its unique reactivity and potential applications in medicinal chemistry. The aldehyde functional group at the 5-position enhances its reactivity, making it suitable for various synthetic transformations. This compound may exhibit biological activity, which is often explored in drug discovery and development. Its structural features suggest potential interactions with biological targets, and it may serve as a scaffold for the design of new pharmaceuticals. Additionally, the presence of halogen substituents can influence its solubility, stability, and overall chemical behavior. As with many organic compounds, handling should be done with care, considering safety protocols due to the presence of halogens and the reactive aldehyde group.

Formula: C₁₁H₈BrClN₂O

InChI: InChI=1/C11H8BrClN2O/c12-10-5-14-15(11(10)7-16)6-8-1-3-9(13)4-2-8/h1-5,7H,6H2

SMILES: c1cc(ccc1Cn1c(C=O)c(cn1)Br)Cl

1H-Pyrazole-5-carboxaldehyde, 4-bromo-1-[(4-chlorophenyl)methyl]-

CAS: 289504-53-6

Formula: C₁₁H₈BrClN₂O

Molecular weight: 299.551

Ref: IN-DA002X66

4-Bromo-1-(4-chlorobenzyl)-1H-pyrazole-5-carboxaldehyde

CAS: 289504-53-6

4-Bromo-1-(4-chlorobenzyl)-1H-pyrazole-5-carboxaldehyde

Purity: ≥95%

Molecular weight: 299.55g/mol

Ref: 54-OR8036