CAS 28958-90-9
:(7S)-2-amino-4,5,6,7-tetrahydro-1H-1,3-diazepine-7-carboxylic acid
Description:
(7S)-2-amino-4,5,6,7-tetrahydro-1H-1,3-diazepine-7-carboxylic acid, with CAS number 28958-90-9, is a bicyclic compound featuring a diazepine ring structure. This substance is characterized by the presence of an amino group and a carboxylic acid functional group, which contribute to its potential as a building block in pharmaceutical chemistry. The stereochemistry indicated by the (7S) designation suggests specific spatial arrangements of atoms, which can influence the compound's biological activity and interactions. The tetrahydro configuration indicates that the diazepine ring is saturated, which typically enhances stability and solubility in biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions, due to its structural similarity to neurotransmitters or other biologically active molecules. Its unique structural features and functional groups make it a subject of interest for further research in synthetic and medicinal chemistry.
Formula:C6H11N3O2
InChI:InChI=1/C6H11N3O2/c7-6-8-3-1-2-4(9-6)5(10)11/h4H,1-3H2,(H,10,11)(H3,7,8,9)/t4-/m0/s1
SMILES:C1C[C@@H](C(=O)O)NC(=N)NC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1H-1,3-Diazepine-4-carboxylicacid, 2-amino-4,5,6,7-tetrahydro-, (S)- (9CI)
CAS:Formula:C6H11N3O2Molecular weight:157.1704


