CymitQuimica logo

CAS 2896-55-1

:

5,5'-ethane-1,2-diylbis[2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-6-ol]

Description:
5,5'-Ethane-1,2-diylbis[2,7,8-trimethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydro-2H-chromen-6-ol], with CAS number 2896-55-1, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups and a significant degree of branching in its alkyl chains. This compound features a chromenol backbone, which is indicative of its potential applications in fields such as pharmaceuticals and materials science. The presence of multiple methyl groups contributes to its hydrophobic nature, enhancing its solubility in non-polar solvents. Additionally, the compound's structural features suggest it may exhibit antioxidant properties, making it of interest in formulations aimed at stabilizing products against oxidative degradation. Its unique arrangement of substituents may also influence its biological activity and interactions with other molecules. Overall, this compound exemplifies the complexity often found in synthetic organic chemistry, with potential implications in various industrial and research applications.
Formula:C58H98O4
InChI:InChI=1/C58H98O4/c1-39(2)21-15-23-41(5)25-17-27-43(7)29-19-35-57(13)37-33-51-49(53(59)45(9)47(11)55(51)61-57)31-32-50-52-34-38-58(14,62-56(52)48(12)46(10)54(50)60)36-20-30-44(8)28-18-26-42(6)24-16-22-40(3)4/h39-44,59-60H,15-38H2,1-14H3
SMILES:CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2c(CCc3c4CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)Oc4c(C)c(C)c3O)c(c(C)c(C)c2O1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.