CAS 28965-57-3
:Holmium oxalate decahydrate
Description:
Holmium oxalate decahydrate is a chemical compound composed of holmium, an element belonging to the lanthanide series, and oxalic acid. It is characterized by its crystalline structure, typically forming colorless to pale yellow crystals. The decahydrate form indicates that it contains ten molecules of water (H2O) for each formula unit, which contributes to its solubility and stability in aqueous solutions. Holmium oxalate is often used in various applications, including research in materials science and as a precursor for the synthesis of holmium-containing materials. The compound exhibits properties typical of lanthanide oxalates, such as thermal stability and the ability to form complexes with other ligands. Additionally, holmium ions can exhibit unique optical and magnetic properties, making holmium oxalate of interest in fields such as photonics and magnetic materials. Safety precautions should be observed when handling this compound, as with many lanthanide compounds, due to potential toxicity and environmental considerations.
Formula:C2H20HoO14
InChI:InChI=1/C2H2O4.Ho.10H2O/c3-1(4)2(5)6;;;;;;;;;;;/h(H,3,4)(H,5,6);;10*1H2/q;+3;;;;;;;;;;/p-2
Synonyms:- HolmiumoxalatedecahydrateREOoffwhitepowder
- Holmium (III) oxalate decahydrate (99.9%-Ho) (REO)
- Holmium Ethanedioate (2:3)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
