CAS 28979-74-0
:2-D-Alanine-4-[4-(dimethylamino)-N-methyl-L-
Description:
2-D-Alanine-4-[4-(dimethylamino)-N-methyl-L-] is a chemical compound that belongs to the class of amino acids, specifically a derivative of alanine. It features a dimethylamino group, which contributes to its basicity and potential interactions in biological systems. The presence of the N-methyl group indicates that it is a substituted derivative, which can influence its solubility and reactivity. This compound may exhibit properties typical of amino acids, such as the ability to participate in peptide bond formation and act as a building block for proteins. Additionally, the dimethylamino group can enhance its pharmacological properties, making it of interest in medicinal chemistry. The compound's structure suggests it may have applications in drug design or as a biochemical probe. However, specific characteristics such as melting point, solubility, and biological activity would require empirical data for precise evaluation. As with many amino acid derivatives, its behavior in biological systems can be complex, influenced by factors such as pH and the presence of other biomolecules.
Formula:C45H55N7O8
InChI:InChI=1/C44H52N8O10/c1-25-41(58)51-21-10-13-31(51)42(59)50(5)33(23-27-15-17-29(18-16-27)49(3)4)43(60)52-22-19-30(53)24-32(52)38(55)48-36(28-11-7-6-8-12-28)44(61)62-26(2)35(39(56)46-25)47-40(57)37-34(54)14-9-20-45-37/h6-9,11-12,14-18,20,25-26,31-33,35-36,54H,10,13,19,21-24H2,1-5H3,(H,46,56)(H,47,57)(H,48,55)
Synonyms:- Vernamycin B&g
- pristinamycin IC
- 2-D-Alanine-4-[4-(dimethylamino)-N-methyl-L-
- vernamycin Bgamma
- Pristinamycin ⅠC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pristinamycin ⅠC
CAS:Pristinamycin IC is an ester peptide antibiotic with activity against Gram-positive bacteria.Formula:C44H52N8O10Color and Shape:SolidMolecular weight:852.931
