CAS 28989-50-6

4-(thiophen-2-yl)-1,3-thiazol-2-amine

Description:

4-(Thiophen-2-yl)-1,3-thiazol-2-amine is an organic compound characterized by its unique structural features, which include a thiazole ring and a thiophene moiety. The thiazole ring contributes to its heterocyclic nature, while the thiophene provides additional aromatic characteristics. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity due to the presence of amino and thiazole functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in synthetic organic chemistry. The presence of sulfur in both the thiophene and thiazole rings can influence its electronic properties, potentially leading to interesting photophysical behavior. Additionally, compounds with similar structures have been studied for biological activities, including antimicrobial and anticancer properties, suggesting that 4-(thiophen-2-yl)-1,3-thiazol-2-amine may also exhibit pharmacological potential. Overall, its unique structure and functional groups make it a compound of interest in both academic research and potential applications in pharmaceuticals.

Formula: C₇H₆N₂S₂

InChI: InChI=1/C7H6N2S2/c8-7-9-5(4-11-7)6-2-1-3-10-6/h1-4H,(H2,8,9)

SMILES: c1cc(c2csc(=N)[nH]2)sc1

Synonyms:

• 2-Thiazolamine, 4-(2-thienyl)-
• 4-(2-Thienyl)-1,3-thiazol-2-amine

2-Thiazolamine, 4-(2-thienyl)-

CAS: 28989-50-6

Formula: C₇H₆N₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 182.2659

Ref: IN-DA002V3W

4-(Thiophen-2-Yl)Thiazol-2-Amine

CAS: 28989-50-6

4-(Thiophen-2-Yl)Thiazol-2-Amine

Purity: 97%

Molecular weight: 182.27g/mol

Ref: 54-OR1011201

4-Thiophen-2-yl-thiazol-2-ylamine

CAS: 28989-50-6

Formula: C₇H₆N₂S₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 182.26

Ref: 10-F014123

Avatrombopag Impurity 15

CAS: 28989-50-6

Formula: C₇H₆N₂S₂

Molecular weight: 182.26

Ref: ST-EA-CP-A135010