CAS 2899-36-7
:L-Methionine, ethyl ester, hydrochloride (1:1)
Description:
L-Methionine, ethyl ester, hydrochloride (1:1) is a derivative of the essential amino acid L-methionine, which plays a crucial role in various biological processes, including protein synthesis and methylation reactions. This compound is typically encountered as a white to off-white crystalline powder, indicating its solid state at room temperature. It is soluble in water, which facilitates its use in various biochemical applications and nutritional supplements. The hydrochloride form enhances its stability and solubility, making it more bioavailable. L-Methionine is known for its antioxidant properties and is involved in the synthesis of other important biomolecules, such as cysteine and taurine. Additionally, it serves as a precursor for the synthesis of S-adenosylmethionine (SAMe), a critical methyl donor in numerous methylation reactions. The compound is generally regarded as safe when used appropriately, but like all amino acids, it should be consumed in moderation to avoid potential imbalances in amino acid levels. Overall, L-Methionine, ethyl ester, hydrochloride is valued in both research and dietary contexts for its functional properties.
Formula:C7H15NO2S·ClH
InChI:InChI=1S/C7H15NO2S.ClH/c1-3-10-7(9)6(8)4-5-11-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1
InChI key:InChIKey=KPWCQEUBJAIORR-RGMNGODLSA-N
SMILES:[C@@H](C(OCC)=O)(CCSC)N.Cl
Synonyms:- (2S)-1-ethoxy-4-(methylsulfanyl)-1-oxobutan-2-aminium
- 221-381-1
- <span class="text-smallcaps">L</span>-Methionine O-ethyl ester hydrochloride
- <span class="text-smallcaps">L</span>-Methionine, ethyl ester, hydrochloride
- <span class="text-smallcaps">L</span>-Methionine, ethyl ester, hydrochloride (1:1)
- Ethyl <span class="text-smallcaps">L</span>-methioninate hydrochloride
- Ethyl L-Methionate Hydrochloride
- Ethyl Methioninate
- Ethyl methioninate hydrochloride
- H-Met-OEt・HCl
- L-methionine, ethyl ester
- Methionine ethyl ester hydrochloride
- Methionine, ethyl ester, L-
- Methionine, ethyl ester, hydrochloride, <span class="text-smallcaps">L</span>-
- S-Methionine ethyl ester hydrochloride
- ethyl L-methioninate
- ethyl L-methioninate hydrochloride
- L-Methionine, ethyl ester, hydrochloride (1:1)
- L-Methionine, ethyl ester, hydrochloride
- L-Methionine O-ethyl ester hydrochloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Methionine ethyl ester, HCl
CAS:Formula:C7H16ClNO2SPurity:98%Color and Shape:SolidMolecular weight:213.7254(S)-Ethyl 2-amino-4-(methylthio)butanoate hydrochloride
CAS:(S)-Ethyl 2-amino-4-(methylthio)butanoate hydrochlorideFormula:C7H15NO2S·ClHPurity:98%Color and Shape: white to off-white solidMolecular weight:213.73g/molL-Methionine ethyl ester HCl
CAS:L-Methionine ethyl ester HCl is a chiral compound that is an amino acid. It is not used in the synthesis of proteins, but instead for use as a nutritional supplement. L-Methionine ethyl ester HCl has been shown to have regenerative properties in tissue culture and tumor cell lines. It may also be useful for the synthesis of peptides or other products using enzymatic methods.Formula:C7H15NO2S·HClPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:213.73 g/molL-Methionine ethyl ester hydrochloride
CAS:Formula:C7H16ClNO2SPurity:≥99%Color and Shape:Solid, White powderMolecular weight:213.72




