CAS 289905-88-0
:1-[(2-chlorophenyl)(diphenyl)methyl]-1H-pyrazole
Description:
1-[(2-chlorophenyl)(diphenyl)methyl]-1H-pyrazole, identified by its CAS number 289905-88-0, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a 2-chlorophenyl group and a diphenylmethyl group, contributing to its unique structural and electronic properties. The presence of the chlorine atom on the phenyl ring can influence the compound's reactivity and solubility, while the diphenylmethyl moiety enhances its steric bulk. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The overall molecular structure suggests potential interactions with biological targets, which could lead to various pharmacological effects. Additionally, the compound's stability, solubility in organic solvents, and potential for forming hydrogen bonds are important characteristics that can affect its behavior in chemical reactions and applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C22H17ClN2
InChI:InChI=1/C22H17ClN2/c23-21-15-8-7-14-20(21)22(25-17-9-16-24-25,18-10-3-1-4-11-18)19-12-5-2-6-13-19/h1-17H
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1Cl)n1cccn1
Synonyms:- 1-[(2-Chlorophenyl)diphenylmethyl]-1H-pyrazole
- 1H-Pyrazole, 1-[(2-chlorophenyl)diphenylmethyl]-
- TRAM-34
- 1-[(2-Chlorophenyl)(diphenyl)methyl]-1H-pyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
1H-Pyrazole, 1-[(2-chlorophenyl)diphenylmethyl]-
CAS:Formula:C22H17ClN2Purity:98%Color and Shape:SolidMolecular weight:344.83681-((2-Chlorophenyl)Diphenylmethyl)-1H-Pyrazole
CAS:1-((2-Chlorophenyl)Diphenylmethyl)-1H-PyrazolePurity:98%Molecular weight:344.84g/molTRAM-34
CAS:Formula:C22H17ClN2Purity:≥ 98%Color and Shape:White powder or solidMolecular weight:344.84TRAM-34
CAS:<p>TRAM-34 (Triarylmethane-34), an effective and specific inhibitor of the intermediate-conductance Ca2+-activated K+ channel, does not block cytochrome P450.</p>Formula:C22H17ClN2Purity:99.01% - 99.91%Color and Shape:SolidMolecular weight:344.84TRAM-34
CAS:Controlled Product<p>Applications TRAM-34 blocks intermediate conductance calcium-activated potassium channel IKCa1 with a Kd of 20nM and exhibits exquisite selectivity for the channel. Clotrimazole impurity.<br>References Wulff, H., et al.: J. of Biological Chemistry, 276, 34, 32040 (2001)<br></p>Formula:C22H17ClN2Color and Shape:NeatMolecular weight:344.841-((2-Chlorophenyl)diphenylmethyl)-1H-pyrazole
CAS:Formula:C22H17ClN2Purity:98%Molecular weight:344.84TRAM 34
CAS:<p>Inhibitor of calcium-activated potassium channels</p>Formula:C22H17ClN2Purity:Min. 95%Molecular weight:344.84 g/mol









