CymitQuimica logo

CAS 28998-36-9

:

4-amino-1-(2,3,5-tri-O-benzoylpentofuranosyl)-1,3,5-triazin-2(1H)-one

Description:
4-amino-1-(2,3,5-tri-O-benzoylpentofuranosyl)-1,3,5-triazin-2(1H)-one is a complex organic compound characterized by its triazine core and a pentofuranosyl moiety that is heavily substituted with benzoyl groups. The presence of the amino group contributes to its potential as a nucleophile in various chemical reactions. The benzoyl groups enhance the compound's lipophilicity and stability, making it suitable for applications in medicinal chemistry and biochemistry. The structure suggests that it may exhibit interesting biological activities, possibly related to its interaction with nucleic acids or proteins. Additionally, the compound's solubility and reactivity can be influenced by the steric and electronic effects of the benzoyl substituents. As a triazine derivative, it may also participate in various chemical transformations, including substitution and condensation reactions. Overall, this compound represents a unique class of triazine-based molecules with potential applications in drug development and biochemical research.
Formula:C29H24N4O8
InChI:InChI=1/C29H24N4O8/c30-28-31-17-33(29(37)32-28)24-23(41-27(36)20-14-8-3-9-15-20)22(40-26(35)19-12-6-2-7-13-19)21(39-24)16-38-25(34)18-10-4-1-5-11-18/h1-15,17,21-24H,16H2,(H2,30,32,37)
SMILES:c1ccc(cc1)C(=O)OCC1C(C(C(n2cnc(=N)nc2O)O1)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.