CAS 29001-27-2
:6-Amino-7-methoxy-4-methyl-2H-1-benzopyran-2-one
Description:
6-Amino-7-methoxy-4-methyl-2H-1-benzopyran-2-one, with the CAS number 29001-27-2, is a chemical compound belonging to the class of benzopyran derivatives. This compound features a benzopyran core, which is characterized by a fused benzene and pyran ring structure. The presence of an amino group at the 6-position and a methoxy group at the 7-position contributes to its unique reactivity and potential biological activity. The methyl group at the 4-position further modifies its properties. This compound may exhibit various pharmacological activities, including antioxidant and anti-inflammatory effects, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in research and potential therapeutic uses. Overall, 6-Amino-7-methoxy-4-methyl-2H-1-benzopyran-2-one represents a structurally interesting molecule with potential implications in drug development and other chemical applications.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c1-6-3-11(13)15-9-5-10(14-2)8(12)4-7(6)9/h3-5H,12H2,1-2H3
InChI key:InChIKey=SQSFFVYHKYAFRZ-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(OC)=C(N)C2)OC(=O)C1
Synonyms:- Coumarin, 6-amino-7-methoxy-4-methyl-
- 6-Amino-7-methoxy-4-methyl-2H-1-benzopyran-2-one
- NSC 299881
- 2H-1-Benzopyran-2-one, 6-amino-7-methoxy-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Amino-7-methoxy-4-methyl-2H-chromen-2-one
CAS:Controlled ProductFormula:C11H11NO3Color and Shape:NeatMolecular weight:205.21

