CAS 2901-29-3
:Ethyl β-oxo-α-phenylbenzenebutanoate
Description:
Ethyl β-oxo-α-phenylbenzenebutanoate, with the CAS number 2901-29-3, is an organic compound that belongs to the class of esters. It features a phenyl group attached to a butanoate moiety, which contributes to its structural complexity. The compound typically exhibits a moderate to high boiling point due to the presence of multiple functional groups, including the ester and ketone functionalities. Ethyl β-oxo-α-phenylbenzenebutanoate is generally characterized by its solubility in organic solvents, such as ethanol and ether, while being less soluble in water. The compound may display a range of chemical reactivity, including the ability to undergo hydrolysis, condensation, and various substitution reactions, making it useful in synthetic organic chemistry. Additionally, it may exhibit biological activity, which could be of interest in pharmaceutical applications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H18O3
InChI:InChI=1S/C18H18O3/c1-2-21-18(20)17(15-11-7-4-8-12-15)16(19)13-14-9-5-3-6-10-14/h3-12,17H,2,13H2,1H3
InChI key:InChIKey=GVNHSMZHSWFYMB-UHFFFAOYSA-N
SMILES:C(C(CC1=CC=CC=C1)=O)(C(OCC)=O)C2=CC=CC=C2
Synonyms:- Acetoacetic acid, 2,4-diphenyl-, ethyl ester
- Benzenebutanoic acid, β-oxo-α-phenyl-, ethyl ester
- Ethyl α,γ-diphenylacetoacetate
- Ethyl β-oxo-α-phenylbenzenebutanoate
- 3-Oxo-2,4-diphenylbutyric acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
