CAS 2901-44-2

[4-(acetylamino)cyclohexyl]acetic acid

Description:

[4-(Acetylamino)cyclohexyl]acetic acid, with the CAS number 2901-44-2, is an organic compound characterized by its cyclohexyl structure substituted with an acetylamino group and a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The acetylamino group contributes to its potential biological activity, making it of interest in pharmaceutical research. The compound's structure suggests it may exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Its melting point, boiling point, and other physical properties would be influenced by the molecular interactions within its structure. As with many organic compounds, proper handling and safety measures should be observed, as it may pose risks if ingested or improperly managed.

Formula: C₁₀H₁₇NO₃

InChI: InChI=1/C10H17NO3/c1-7(12)11-9-4-2-8(3-5-9)6-10(13)14/h8-9H,2-6H2,1H3,(H,11,12)(H,13,14)/t8-,9-

SMILES: CC(=N[C@H]1CC[C@@H](CC1)CC(=O)O)O

Nsc175383

CAS: 2901-44-2

Formula: C₁₀H₁₇NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 199.2469

Ref: IN-DA00BF0Q

trans-4-Acetamidocyclohexaneacetic acid

CAS: 2901-44-2

trans-4-Acetamidocyclohexaneacetic acid

Purity: 98%

Molecular weight: 199.25g/mol

Ref: 54-OR1061271